Inquiry Basket
H-Tic(7-OH)-OH is a possible inhibitor of histone deacetylases (HDACs).
| Synonyms | |
|---|---|
| Synonyms | H-Tic(7-OH)-OH; H-Tic(7-Hydroxy)-OH; (3S)-1,2,3,4-Tetrahydroisoquinoline-7-hydroxy-3-carboxylic acid |
| Appearance | |
| Appearance | White powder |
| Purity | |
| Purity | ≥ 98% |
| Density | |
| Density | 1.351 g/cm3 |
| Melting Point | |
| Melting Point | 336 - 338ºC |
| Boiling Point | |
| Boiling Point | 456.3ºC at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C10H11NO3/c12-8-2-1-6-4-9(10(13)14)11-5-7(6)3-8/h1-3,9,11-12H,4-5H2,(H,13,14)/t9-/m0/s1 |
| InChI Key | |
| InChI Key | HIKCRLDSCSWXML-VIFPVBQESA-N |
| Canonical SMILES | |
| Canonical SMILES | C1C(NCC2=C1C=CC(=C2)O)C(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
