Inquiry Basket
Synonyms | |
---|---|
Synonyms | L-Cys(Bzl)-OH; (R)-2-Amino-3-benzylsulfanyl-propionic acid |
Appearance | |
Appearance | White to off-white crystalline powder |
Purity | |
Purity | ≥ 98% |
Density | |
Density | 1.22 g/cm3 |
Melting Point | |
Melting Point | 208-214 ºC |
Boiling Point | |
Boiling Point | 350.9°C |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C10H13NO2S/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m0/s1 |
InChI Key | |
InChI Key | GHBAYRBVXCRIHT-VIFPVBQESA-N |
Canonical SMILES | |
Canonical SMILES | C1=CC=C(C=C1)CSCC(C(=O)O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2