Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | Sar-OMe HCl; N-Methylglycine methyl ester hydrochloride |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 98% (HPLC) |
| Density | |
| Density | g/cm3 |
| Melting Point | |
| Melting Point | 113-123 °C |
| Boiling Point | |
| Boiling Point | 118.9ºC at 760 mmHg |
| Storage | |
| Storage | Store at 2-8°C |
| InChI | |
| InChI | InChI=1S/C4H9NO2.ClH/c1-5-3-4(6)7-2;/h5H,3H2,1-2H3;1H |
| InChI Key | |
| InChI Key | HQZMRJBVCVYVQA-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | CNCC(=O)OC.Cl |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
