Inquiry Basket
A substrate for the determination of chymotrypsin activity.
Synonyms | |
---|---|
Synonyms | Suc-L-Phe-pNA; 4-({1-Benzyl-2-[(4-Nitrophenyl)Amino]-2-Oxoethyl}Amino)-4-Oxobutanoic Acid; (S)-4-[[2-[(4-Nitrophenyl)Amino]-2-Oxo-1-(Phenylmethyl)Ethyl]Amino]-4-Oxobutyric Acid; 4-((1-Benzyl-2-[(4-Nitrophenyl)Amino]-2-Oxoethyl)Amino)-4-Oxobutanoic Acid |
Purity | |
Purity | 95% |
Density | |
Density | 1.383±0.06 g/cm3(Predicted) |
Boiling Point | |
Boiling Point | 769.3±60.0 °C(Predicted) |
Storage | |
Storage | Store at 2-8°C |
InChI | |
InChI | InChI=1S/C19H19N3O6/c23-17(10-11-18(24)25)21-16(12-13-4-2-1-3-5-13)19(26)20-14-6-8-15(9-7-14)22(27)28/h1-9,16H,10-12H2,(H,20,26)(H,21,23)(H,24,25) |
InChI Key | |
InChI Key | KNBLWBFJHZHYFG-UHFFFAOYSA-N |
Canonical SMILES | |
Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)CCC(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2