Inquiry Basket
T7 Tag Peptide, an epitope tag composed of an 11-residue peptide encoded from the leader sequence of the T7 bacteriophage gene10, and serves as a tag in many expression vectors that is based on the very efficient T7 RNA polymerase expression system.
| IUPAC Name | |
|---|---|
| IUPAC Name | 2-[[(2S)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-2-[[2-[[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]propanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylsulfanylbutanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetic acid |
| Synonyms | |
| Synonyms | Met-Ala-Ser-Met-Thr-Gly-Gly-Gln-Gln-Met-Gly; L-methionyl-L-alanyl-L-seryl-L-methionyl-(3xi)-L-threonyl-glycyl-glycyl-L-glutaminyl-L-glutaminyl-L-methionyl-glycine |
| Appearance | |
| Appearance | White Lyophilized Powder |
| Purity | |
| Purity | ≥95% |
| Density | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | |
| Boiling Point | 1724.5±65.0°C at 760 mmHg |
| Sequence | |
| Sequence | MASMTGGQQMG |
| Storage | |
| Storage | Store at -20°C |
| Solubility | |
| Solubility | Soluble in Water, DMSO |
| InChI | |
| InChI | InChI=1S/C41H71N13O16S3/c1-20(48-35(64)22(42)10-13-71-3)34(63)53-27(19-55)40(69)52-26(12-15-73-5)39(68)54-33(21(2)56)41(70)46-16-30(59)45-17-31(60)49-23(6-8-28(43)57)37(66)50-24(7-9-29(44)58)38(67)51-25(11-14-72-4)36(65)47-18-32(61)62/h20-27,33,55-56H,6-19,42H2,1-5H3,(H2,43,57)(H2,44,58)(H,45,59)(H,46,70)(H,47,65)(H,48,64)(H,49,60)(H,50,66)(H,51,67)(H,52,69)(H,53,63)(H,54,68)(H,61,62)/t20-,21?,22-,23-,24-,25-,26-,27-,33-/m0/s1 |
| InChI Key | |
| InChI Key | CBOSLARKSDSTLV-PESOZTNGSA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(C(C(=O)NCC(=O)NCC(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CCSC)C(=O)NCC(=O)O)NC(=O)C(CCSC)NC(=O)C(CO)NC(=O)C(C)NC(=O)C(CCSC)N)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
Three to One Letter Converter: Pull down the menu to view the 3 to 1 conversion.
Enter Peptide Sequence in Box (use one letter code)
Length: Residues
Molecular Weight: g/mol
Molecular formula:
