Inquiry Basket
Boc-(±)-trans-4-(3-fluorophenyl)pyrrolidine-3-carboxylic Acid is used to prepare pyrrolidinylurea and pyrrolidinylthiourea compounds as TrkA kinase inhibitors.
| Synonyms | |
|---|---|
| Synonyms | Boc-(±)-trans-4-(3-fluorophenyl)pyrrolidine-3-carboxylic acid; (3R,4S)-4-(3-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid; Boc-trans-DL-b-Pro-4-(3-fluorophenyl)-OH; BOC-TRANS-4-(3-FLUOROPHENYL)-PYRROLIDINE-3-CARBOXYLIC ACID; Boc-trans-DL-β-Pro-4-(3-fluorophenyl)-OH |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 99% (HPLC) |
| Density | |
| Density | 1.249±0.060 g/cm3 |
| Boiling Point | |
| Boiling Point | 437.3±45.0 °C |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C16H20FNO4/c1-16(2,3)22-15(21)18-8-12(13(9-18)14(19)20)10-5-4-6-11(17)7-10/h4-7,12-13H,8-9H2,1-3H3,(H,19,20)/t12-,13+/m1/s1 |
| InChI Key | |
| InChI Key | NUVNFNVJYJQLRA-OLZOCXBDSA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(C)(C)OC(=O)N1CC(C(C1)C(=O)O)C2=CC(=CC=C2)F |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
