Inquiry Basket
TRAP-5 is a thrombin receptor activator. Thrombin receptor is a G protein-coupled receptor involved in the regulation of thrombotic response.
| Catalog Number | Size | Price | Stock | Quantity |
|---|---|---|---|---|
| BAT-006219 | 10 mg | $198 | In stock |
| IUPAC Name | |
|---|---|
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| Synonyms | |
| Synonyms | Thrombin Receptor Activator for Peptide 5 (TRAP-5) |
| Purity | |
| Purity | 98% |
| Sequence | |
| Sequence | H-Ser-Phe-Leu-Leu-Arg-OH |
| Storage | |
| Storage | -15ºC |
| InChI | |
| InChI | InChI=1S/C30H50N8O7/c1-17(2)13-22(26(41)35-21(29(44)45)11-8-12-34-30(32)33)37-27(42)23(14-18(3)4)38-28(43)24(36-25(40)20(31)16-39)15-19-9-6-5-7-10-19/h5-7,9-10,17-18,20-24,39H,8,11-16,31H2,1-4H3,(H,35,41)(H,36,40)(H,37,42)(H,38,43)(H,44,45)(H4,32,33,34)/t20-,21-,22-,23-,24-/m0/s1 |
| InChI Key | |
| InChI Key | LJYDIYITSYDTAY-LSBAASHUSA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C(=O)O)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CO)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
