Inquiry Basket
A building block used in the synthesis of dipeptidyl peptidase IV inhibitors and HIV integrase inhibitors.
| IUPAC Name | |
|---|---|
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate |
| Synonyms | |
| Synonyms | (S)-1-Benzyl 2-methyl 4-oxopyrrolidine-1,2-dicarboxylate; (S)-L-benzyl-2-methyl 4-oxopyrrolidine-1,2-dicarboxylate |
| Appearance | |
| Appearance | Light yellow oil |
| Purity | |
| Purity | 95% |
| Density | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | |
| Boiling Point | 422.1±45.0 °C at 760 mmHg |
| InChI | |
| InChI | InChI=1S/C14H15NO5/c1-19-13(17)12-7-11(16)8-15(12)14(18)20-9-10-5-3-2-4-6-10/h2-6,12H,7-9H2,1H3/t12-/m0/s1 |
| InChI Key | |
| InChI Key | XRFKZAWVKVORNI-LBPRGKRZSA-N |
| Canonical SMILES | |
| Canonical SMILES | COC(=O)C1CC(=O)CN1C(=O)OCC2=CC=CC=C2 |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
