Inquiry Basket
Z-Ala-Ala-OH is a useful research chemical, an intermediate for the preparation of pseudopeptide macrobicyclic cages used as receptors for N-protected dipeptide guest molecules.
| Synonyms | |
|---|---|
| Synonyms | Z-L-alanyl-L-alanine; N-Cbz-L-Alanyl-L-Alanine; L-Alanine, N-[(Phenylmethoxy)Carbonyl]-L-Alanyl-; Benzyloxycarbonylalanyl Alanine; (S)-2-((S)-2-(((Benzyloxy)Carbonyl)Amino)Propanamido)Propanoic Acid; Z Ala Ala OH |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 99% (HPLC) |
| Density | |
| Density | 1.252g/cm3 |
| Boiling Point | |
| Boiling Point | 573°C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C14H18N2O5/c1-9(12(17)15-10(2)13(18)19)16-14(20)21-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,15,17)(H,16,20)(H,18,19)/t9-,10-/m0/s1 |
| InChI Key | |
| InChI Key | JBGCVTHXXTVYIP-UWVGGRQHSA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(C(=O)NC(C)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
